C19H29NO4Si — CID 155677975
(2S,3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-2-carboxylic acid (PubChem CID 155677975) has the molecular formula C19H29NO4Si and a molecular weight of 363.53 g/mol. Its IUPAC name is (2S,3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-2-carboxylic acid.
| Compound Name | (2S,3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 155677975 |
| Molecular Formula | C19H29NO4Si |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (2S,3S)-1-benzyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-2-carboxylic acid |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N(Cc2ccccc2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C19H29NO4Si/c1-13(24-25(5,6)19(2,3)4)15-16(18(22)23)20(17(15)21)12-14-10-8-7-9-11-14/h7-11,13,15-16H,12H2,1-6H3,(H,22,23)/t13-,15-,16+/m1/s1 |
| InChIKey | DPNOPPUGDLEUFF-BMFZPTHFSA-N |
| XLogP | 3.51 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|