C25H41NO4Si — CID 25109995
(2S)-2-[2-[benzyl-[2-tri(propan-2-yl)silyloxyethyl]amino]-2-oxoethyl]pent-4-enoic acid (PubChem CID 25109995) has the molecular formula C25H41NO4Si and a molecular weight of 447.69 g/mol. Its IUPAC name is (2S)-2-[2-[benzyl-[2-tri(propan-2-yl)silyloxyethyl]amino]-2-oxoethyl]pent-4-enoic acid.
| Compound Name | (2S)-2-[2-[benzyl-[2-tri(propan-2-yl)silyloxyethyl]amino]-2-oxoethyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 25109995 |
| Molecular Formula | C25H41NO4Si |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | (2S)-2-[2-[benzyl-[2-tri(propan-2-yl)silyloxyethyl]amino]-2-oxoethyl]pent-4-enoic acid |
| SMILES | C=CC[C@@H](CC(=O)N(CCO[Si](C(C)C)(C(C)C)C(C)C)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H41NO4Si/c1-8-12-23(25(28)29)17-24(27)26(18-22-13-10-9-11-14-22)15-16-30-31(19(2)3,20(4)5)21(6)7/h8-11,13-14,19-21,23H,1,12,15-18H2,2-7H3,(H,28,29)/t23-/m0/s1 |
| InChIKey | PWYNXPBUOILUIZ-QHCPKHFHSA-N |
| XLogP | 5.87 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|