C23H34ClNO4Si — CID 122227069
methyl (3R,5E,7R,8R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate (PubChem CID 122227069) has the molecular formula C23H34ClNO4Si and a molecular weight of 452.07 g/mol. Its IUPAC name is methyl (3R,5E,7R,8R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate.
| Compound Name | methyl (3R,5E,7R,8R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
|---|---|
| PubChem CID | 122227069 |
| Molecular Formula | C23H34ClNO4Si |
| Molecular Weight | 452.07 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | methyl (3R,5E,7R,8R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
| SMILES | COC(=O)[C@H]1/C=C/C[C@@H](O[Si](C)(C)C(C)(C)C)CN(Cc2ccccc2)C(=O)[C@@H]1Cl |
| InChI | InChI=1S/C23H34ClNO4Si/c1-23(2,3)30(5,6)29-18-13-10-14-19(22(27)28-4)20(24)21(26)25(16-18)15-17-11-8-7-9-12-17/h7-12,14,18-20H,13,15-16H2,1-6H3/b14-10+/t18-,19+,20-/m1/s1 |
| InChIKey | KUWIZWDULYXQOR-CSQTXCJASA-N |
| XLogP | 4.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.07 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|