C20H26ClNO5 — CID 122227071
ethyl (3R,5E,7R,8R)-1-benzyl-8-chloro-3-(methoxymethoxy)-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate (PubChem CID 122227071) has the molecular formula C20H26ClNO5 and a molecular weight of 395.88 g/mol. Its IUPAC name is ethyl (3R,5E,7R,8R)-1-benzyl-8-chloro-3-(methoxymethoxy)-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate.
| Compound Name | ethyl (3R,5E,7R,8R)-1-benzyl-8-chloro-3-(methoxymethoxy)-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
|---|---|
| PubChem CID | 122227071 |
| Molecular Formula | C20H26ClNO5 |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl (3R,5E,7R,8R)-1-benzyl-8-chloro-3-(methoxymethoxy)-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1/C=C/C[C@@H](OCOC)CN(Cc2ccccc2)C(=O)[C@@H]1Cl |
| InChI | InChI=1S/C20H26ClNO5/c1-3-26-20(24)17-11-7-10-16(27-14-25-2)13-22(19(23)18(17)21)12-15-8-5-4-6-9-15/h4-9,11,16-18H,3,10,12-14H2,1-2H3/b11-7+/t16-,17+,18-/m1/s1 |
| InChIKey | SWFIYRLFPLXOEA-DRBQWCDHSA-N |
| XLogP | 2.75 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|