C39H37NO4 — CID 139194610
1-phenyl-2-piperidin-1-ylethane-1,2-dione;1,1,2,2-tetraphenylethane-1,2-diol (PubChem CID 139194610) has the molecular formula C39H37NO4 and a molecular weight of 583.73 g/mol. Its IUPAC name is 1-phenyl-2-piperidin-1-ylethane-1,2-dione;1,1,2,2-tetraphenylethane-1,2-diol.
| Compound Name | 1-phenyl-2-piperidin-1-ylethane-1,2-dione;1,1,2,2-tetraphenylethane-1,2-diol |
|---|---|
| PubChem CID | 139194610 |
| Molecular Formula | C39H37NO4 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | 1-phenyl-2-piperidin-1-ylethane-1,2-dione;1,1,2,2-tetraphenylethane-1,2-diol |
| SMILES | O=C(C(=O)N1CCCCC1)c1ccccc1.OC(c1ccccc1)(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22O2.C13H15NO2/c27-25(21-13-5-1-6-14-21,22-15-7-2-8-16-22)26(28,23-17-9-3-10-18-23)24-19-11-4-12-20-24;15-12(11-7-3-1-4-8-11)13(16)14-9-5-2-6-10-14/h1-20,27-28H;1,3-4,7-8H,2,5-6,9-10H2 |
| InChIKey | ATGGOLLLUUFWSI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|