C22H22N2O6 — CID 139195740
acetic acid;(1R,2S,9S,10R)-17,19-diazapentacyclo[8.6.2.22,9.03,8.011,16]icosa-3,5,7,11,13,15-hexaene-18,20-dione (PubChem CID 139195740) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is acetic acid;(1R,2S,9S,10R)-17,19-diazapentacyclo[8.6.2.22,9.03,8.011,16]icosa-3,5,7,11,13,15-hexaene-18,20-dione.
| Compound Name | acetic acid;(1R,2S,9S,10R)-17,19-diazapentacyclo[8.6.2.22,9.03,8.011,16]icosa-3,5,7,11,13,15-hexaene-18,20-dione |
|---|---|
| PubChem CID | 139195740 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | acetic acid;(1R,2S,9S,10R)-17,19-diazapentacyclo[8.6.2.22,9.03,8.011,16]icosa-3,5,7,11,13,15-hexaene-18,20-dione |
| SMILES | CC(=O)O.CC(=O)O.O=C1N[C@H]2c3ccccc3[C@@H]1[C@@H]1NC(=O)[C@H]2c2ccccc21 |
| InChI | InChI=1S/C18H14N2O2.2C2H4O2/c21-17-13-9-5-1-3-7-11(9)15(19-17)14-10-6-2-4-8-12(10)16(13)20-18(14)22;2*1-2(3)4/h1-8,13-16H,(H,19,21)(H,20,22);2*1H3,(H,3,4)/t13-,14+,15+,16-;; |
| InChIKey | HWZDAJKJWISPNZ-OCWZZJSASA-N |
| XLogP | 2.09 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |