C18H20Cl2N4O8 — CID 139196059
N-[[3-[(pyridin-1-ium-2-ylamino)methyl]phenyl]methyl]pyridin-1-ium-2-amine diperchlorate (PubChem CID 139196059) has the molecular formula C18H20Cl2N4O8 and a molecular weight of 491.28 g/mol. Its IUPAC name is N-[[3-[(pyridin-1-ium-2-ylamino)methyl]phenyl]methyl]pyridin-1-ium-2-amine diperchlorate.
| Compound Name | N-[[3-[(pyridin-1-ium-2-ylamino)methyl]phenyl]methyl]pyridin-1-ium-2-amine diperchlorate |
|---|---|
| PubChem CID | 139196059 |
| Molecular Formula | C18H20Cl2N4O8 |
| Molecular Weight | 491.28 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | N-[[3-[(pyridin-1-ium-2-ylamino)methyl]phenyl]methyl]pyridin-1-ium-2-amine diperchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].c1ccc(NCc2cccc(CNc3cccc[nH+]3)c2)[nH+]c1 |
| InChI | InChI=1S/C18H18N4.2ClHO4/c1-3-10-19-17(8-1)21-13-15-6-5-7-16(12-15)14-22-18-9-2-4-11-20-18;2*2-1(3,4)5/h1-12H,13-14H2,(H,19,21)(H,20,22);2*(H,2,3,4,5) |
| InChIKey | RKGIMWQZUVNRNX-UHFFFAOYSA-N |
| XLogP | -6.97 |
| TPSA | 236.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.28 |
| LogP ≤ 5 | -6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |