C24H12F8I2N6O2 — CID 139196794
dipyridin-3-yldiazene;bis((NE)-N-[(2,3,5,6-tetrafluoro-4-iodophenyl)methylidene]hydroxylamine) (PubChem CID 139196794) has the molecular formula C24H12F8I2N6O2 and a molecular weight of 822.19 g/mol. Its IUPAC name is dipyridin-3-yldiazene;bis((NE)-N-[(2,3,5,6-tetrafluoro-4-iodophenyl)methylidene]hydroxylamine).
| Compound Name | dipyridin-3-yldiazene;bis((NE)-N-[(2,3,5,6-tetrafluoro-4-iodophenyl)methylidene]hydroxylamine) |
|---|---|
| PubChem CID | 139196794 |
| Molecular Formula | C24H12F8I2N6O2 |
| Molecular Weight | 822.19 g/mol |
| Exact Mass | 821.90 |
| IUPAC Name | dipyridin-3-yldiazene;bis((NE)-N-[(2,3,5,6-tetrafluoro-4-iodophenyl)methylidene]hydroxylamine) |
| SMILES | O/N=C/c1c(F)c(F)c(I)c(F)c1F.O/N=C/c1c(F)c(F)c(I)c(F)c1F.c1cncc(/N=N/c2cccnc2)c1 |
| InChI | InChI=1S/C10H8N4.2C7H2F4INO/c1-3-9(7-11-5-1)13-14-10-4-2-6-12-8-10;2*8-3-2(1-13-14)4(9)6(11)7(12)5(3)10/h1-8H;2*1,14H/b14-13+;2*13-1+ |
| InChIKey | JKAAAYWDFSOHDZ-AYCZEQSRSA-N |
| XLogP | 8.20 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.19 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|