C34H32N6O4S2 — CID 139197145
bis(4-(4-aminophenyl)sulfonylaniline);4-pyridin-4-ylpyridine (PubChem CID 139197145) has the molecular formula C34H32N6O4S2 and a molecular weight of 652.80 g/mol. Its IUPAC name is bis(4-(4-aminophenyl)sulfonylaniline);4-pyridin-4-ylpyridine.
| Compound Name | bis(4-(4-aminophenyl)sulfonylaniline);4-pyridin-4-ylpyridine |
|---|---|
| PubChem CID | 139197145 |
| Molecular Formula | C34H32N6O4S2 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | bis(4-(4-aminophenyl)sulfonylaniline);4-pyridin-4-ylpyridine |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1.Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/2C12H12N2O2S.C10H8N2/c2*13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h2*1-8H,13-14H2;1-8H |
| InChIKey | QIGDYKQIVOHWJC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 198.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|