C12H9Cl2NO4 — CID 139197385
2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;2-methylpyridin-1-ium (PubChem CID 139197385) has the molecular formula C12H9Cl2NO4 and a molecular weight of 302.11 g/mol. Its IUPAC name is 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;2-methylpyridin-1-ium.
| Compound Name | 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;2-methylpyridin-1-ium |
|---|---|
| PubChem CID | 139197385 |
| Molecular Formula | C12H9Cl2NO4 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;2-methylpyridin-1-ium |
| SMILES | Cc1cccc[nH+]1.O=C1C(O)=C(Cl)C(=O)C([O-])=C1Cl |
| InChI | InChI=1S/C6H2Cl2O4.C6H7N/c7-1-3(9)5(11)2(8)6(12)4(1)10;1-6-4-2-3-5-7-6/h9,12H;2-5H,1H3 |
| InChIKey | KIUALAUMJJFIAZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|