C16H10N4O2 — CID 139197503
1,2-di(indazol-1-yl)ethane-1,2-dione (PubChem CID 139197503) has the molecular formula C16H10N4O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1,2-di(indazol-1-yl)ethane-1,2-dione.
| Compound Name | 1,2-di(indazol-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 139197503 |
| Molecular Formula | C16H10N4O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1,2-di(indazol-1-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)n1ncc2ccccc21)n1ncc2ccccc21 |
| InChI | InChI=1S/C16H10N4O2/c21-15(19-13-7-3-1-5-11(13)9-17-19)16(22)20-14-8-4-2-6-12(14)10-18-20/h1-10H |
| InChIKey | GCIQFXGXADNTGE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|