About indazole-1-carboxamide;trihydrochloride
indazole-1-carboxamide;trihydrochloride (PubChem CID 173083346) has the molecular formula C8H10Cl3N3O
and a molecular weight of 270.55 g/mol. Its IUPAC name is indazole-1-carboxamide;trihydrochloride.
Molecular Properties
| Compound Name | indazole-1-carboxamide;trihydrochloride |
| PubChem CID | 173083346 |
| Molecular Formula | C8H10Cl3N3O |
| Molecular Weight | 270.55 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | indazole-1-carboxamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.NC(=O)n1ncc2ccccc21 |
| InChI | InChI=1S/C8H7N3O.3ClH/c9-8(12)11-7-4-2-1-3-6(7)5-10-11;;;/h1-5H,(H2,9,12);3*1H |
| InChIKey | FLDGYBJVQDVFLC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze indazole-1-carboxamide;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indazole-1-carboxamide;trihydrochloride?
The IUPAC name of indazole-1-carboxamide;trihydrochloride (CID 173083346) is indazole-1-carboxamide;trihydrochloride.
What is the SMILES notation for indazole-1-carboxamide;trihydrochloride?
The canonical SMILES for indazole-1-carboxamide;trihydrochloride is Cl.Cl.Cl.NC(=O)n1ncc2ccccc21.
What is the InChIKey of indazole-1-carboxamide;trihydrochloride?
The InChIKey is FLDGYBJVQDVFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O.3ClH/c9-8(12)11-7-4-2-1-3-6(7)5-10-11;;;/h1-5H,(H2,9,12);3*1H.
What are the key properties of indazole-1-carboxamide;trihydrochloride?
indazole-1-carboxamide;trihydrochloride has a molecular weight of 270.55 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for indazole-1-carboxamide;trihydrochloride is sourced from PubChem (CID 173083346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).