C18H15BF2NO3- — CID 139199023
(9S)-5,5-difluoro-12-methoxy-7-methyl-9-phenyl-4,6-dioxa-2-aza-5-boranuidatricyclo[8.4.0.03,8]tetradeca-1(10),2,7,11,13-pentaene (PubChem CID 139199023) has the molecular formula C18H15BF2NO3- and a molecular weight of 342.13 g/mol. Its IUPAC name is (9S)-5,5-difluoro-12-methoxy-7-methyl-9-phenyl-4,6-dioxa-2-aza-5-boranuidatricyclo[8.4.0.03,8]tetradeca-1(10),2,7,11,13-pentaene.
| Compound Name | (9S)-5,5-difluoro-12-methoxy-7-methyl-9-phenyl-4,6-dioxa-2-aza-5-boranuidatricyclo[8.4.0.03,8]tetradeca-1(10),2,7,11,13-pentaene |
|---|---|
| PubChem CID | 139199023 |
| Molecular Formula | C18H15BF2NO3- |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (9S)-5,5-difluoro-12-methoxy-7-methyl-9-phenyl-4,6-dioxa-2-aza-5-boranuidatricyclo[8.4.0.03,8]tetradeca-1(10),2,7,11,13-pentaene |
| SMILES | COc1ccc2c(c1)[C@H](c1ccccc1)C1=C(C)O[B-](F)(F)OC1=N2 |
| InChI | InChI=1S/C18H15BF2NO3/c1-11-16-17(12-6-4-3-5-7-12)14-10-13(23-2)8-9-15(14)22-18(16)25-19(20,21)24-11/h3-10,17H,1-2H3/q-1/t17-/m0/s1 |
| InChIKey | IVFPKBKQBBAIMD-KRWDZBQOSA-N |
| XLogP | 4.57 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|