C28H23NO — CID 132566743
(7S)-10-methoxy-2-methyl-6,7-diphenyl-7H-benzo[d][1]benzazepine (PubChem CID 132566743) has the molecular formula C28H23NO and a molecular weight of 389.50 g/mol. Its IUPAC name is (7S)-10-methoxy-2-methyl-6,7-diphenyl-7H-benzo[d][1]benzazepine.
| Compound Name | (7S)-10-methoxy-2-methyl-6,7-diphenyl-7H-benzo[d][1]benzazepine |
|---|---|
| PubChem CID | 132566743 |
| Molecular Formula | C28H23NO |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (7S)-10-methoxy-2-methyl-6,7-diphenyl-7H-benzo[d][1]benzazepine |
| SMILES | COc1ccc2c(c1)-c1cc(C)ccc1N=C(c1ccccc1)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C28H23NO/c1-19-13-16-26-25(17-19)24-18-22(30-2)14-15-23(24)27(20-9-5-3-6-10-20)28(29-26)21-11-7-4-8-12-21/h3-18,27H,1-2H3/t27-/m0/s1 |
| InChIKey | BRRSHUBAMJLABB-MHZLTWQESA-N |
| XLogP | 6.94 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |