C15H19NO10 — CID 139199888
[(2R)-2-[(3aR,5S,6R,6aR)-1-acetyl-6-acetyloxy-2-oxo-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-5-yl]-2-acetyloxyethyl] acetate (PubChem CID 139199888) has the molecular formula C15H19NO10 and a molecular weight of 373.31 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5S,6R,6aR)-1-acetyl-6-acetyloxy-2-oxo-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-5-yl]-2-acetyloxyethyl] acetate.
| Compound Name | [(2R)-2-[(3aR,5S,6R,6aR)-1-acetyl-6-acetyloxy-2-oxo-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-5-yl]-2-acetyloxyethyl] acetate |
|---|---|
| PubChem CID | 139199888 |
| Molecular Formula | C15H19NO10 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [(2R)-2-[(3aR,5S,6R,6aR)-1-acetyl-6-acetyloxy-2-oxo-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazol-5-yl]-2-acetyloxyethyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H]1O[C@@H]2OC(=O)N(C(C)=O)[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H19NO10/c1-6(17)16-11-13(24-9(4)20)12(25-14(11)26-15(16)21)10(23-8(3)19)5-22-7(2)18/h10-14H,5H2,1-4H3/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | JQDATYKXJOZHSQ-DHGKCCLASA-N |
| XLogP | -0.49 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|