C18H25NO11 — CID 91178563
[(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-(diacetylamino)oxan-2-yl]methyl acetate (PubChem CID 91178563) has the molecular formula C18H25NO11 and a molecular weight of 431.39 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-(diacetylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-(diacetylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91178563 |
| Molecular Formula | C18H25NO11 |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-(diacetylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC(C)=O)[C@H](N(C(C)=O)C(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H25NO11/c1-8(20)19(9(2)21)15-17(28-12(5)24)16(27-11(4)23)14(7-26-10(3)22)30-18(15)29-13(6)25/h14-18H,7H2,1-6H3/t14-,15-,16-,17-,18?/m1/s1 |
| InChIKey | JXMQAZRXHKKYKN-XNIMBYMISA-N |
| XLogP | -0.54 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|