C27H28N2O7S — CID 139200949
diethyl (2S)-6-[(4-methylphenyl)sulfonylamino]-2-phenyl-2,3-dihydro-1,3-benzoxazine-4,4-dicarboxylate (PubChem CID 139200949) has the molecular formula C27H28N2O7S and a molecular weight of 524.60 g/mol. Its IUPAC name is diethyl (2S)-6-[(4-methylphenyl)sulfonylamino]-2-phenyl-2,3-dihydro-1,3-benzoxazine-4,4-dicarboxylate.
| Compound Name | diethyl (2S)-6-[(4-methylphenyl)sulfonylamino]-2-phenyl-2,3-dihydro-1,3-benzoxazine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 139200949 |
| Molecular Formula | C27H28N2O7S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | diethyl (2S)-6-[(4-methylphenyl)sulfonylamino]-2-phenyl-2,3-dihydro-1,3-benzoxazine-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@H](c2ccccc2)Oc2ccc(NS(=O)(=O)c3ccc(C)cc3)cc21 |
| InChI | InChI=1S/C27H28N2O7S/c1-4-34-25(30)27(26(31)35-5-2)22-17-20(29-37(32,33)21-14-11-18(3)12-15-21)13-16-23(22)36-24(28-27)19-9-7-6-8-10-19/h6-17,24,28-29H,4-5H2,1-3H3/t24-/m0/s1 |
| InChIKey | CWHIUBQZMVDXCB-DEOSSOPVSA-N |
| XLogP | 3.80 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|