C18H18N2O6S — CID 91938313
ethyl 7-(benzenesulfonamido)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate (PubChem CID 91938313) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is ethyl 7-(benzenesulfonamido)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl 7-(benzenesulfonamido)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 91938313 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | ethyl 7-(benzenesulfonamido)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)C1(C)Oc2cc(NS(=O)(=O)c3ccccc3)ccc2NC1=O |
| InChI | InChI=1S/C18H18N2O6S/c1-3-25-17(22)18(2)16(21)19-14-10-9-12(11-15(14)26-18)20-27(23,24)13-7-5-4-6-8-13/h4-11,20H,3H2,1-2H3,(H,19,21) |
| InChIKey | FNLFBGINPKZIJY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|