C16H22N2O6S — CID 97458335
ethyl (2R)-7-(butylsulfonylamino)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate (PubChem CID 97458335) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is ethyl (2R)-7-(butylsulfonylamino)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl (2R)-7-(butylsulfonylamino)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 97458335 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | ethyl (2R)-7-(butylsulfonylamino)-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
| SMILES | CCCCS(=O)(=O)Nc1ccc2c(c1)O[C@@](C)(C(=O)OCC)C(=O)N2 |
| InChI | InChI=1S/C16H22N2O6S/c1-4-6-9-25(21,22)18-11-7-8-12-13(10-11)24-16(3,14(19)17-12)15(20)23-5-2/h7-8,10,18H,4-6,9H2,1-3H3,(H,17,19)/t16-/m1/s1 |
| InChIKey | ITVMEUVWHVOSOU-MRXNPFEDSA-N |
| XLogP | 1.88 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|