C21H22N2O6 — CID 91938286
ethyl 2-methyl-7-[[2-(3-methylphenoxy)acetyl]amino]-3-oxo-4H-1,4-benzoxazine-2-carboxylate (PubChem CID 91938286) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl 2-methyl-7-[[2-(3-methylphenoxy)acetyl]amino]-3-oxo-4H-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl 2-methyl-7-[[2-(3-methylphenoxy)acetyl]amino]-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 91938286 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl 2-methyl-7-[[2-(3-methylphenoxy)acetyl]amino]-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)C1(C)Oc2cc(NC(=O)COc3cccc(C)c3)ccc2NC1=O |
| InChI | InChI=1S/C21H22N2O6/c1-4-27-20(26)21(3)19(25)23-16-9-8-14(11-17(16)29-21)22-18(24)12-28-15-7-5-6-13(2)10-15/h5-11H,4,12H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | GFUHITQMHGAONW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|