C19H16F2N2O5 — CID 91938307
ethyl 7-[(2,5-difluorobenzoyl)amino]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate (PubChem CID 91938307) has the molecular formula C19H16F2N2O5 and a molecular weight of 390.34 g/mol. Its IUPAC name is ethyl 7-[(2,5-difluorobenzoyl)amino]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl 7-[(2,5-difluorobenzoyl)amino]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 91938307 |
| Molecular Formula | C19H16F2N2O5 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | ethyl 7-[(2,5-difluorobenzoyl)amino]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)C1(C)Oc2cc(NC(=O)c3cc(F)ccc3F)ccc2NC1=O |
| InChI | InChI=1S/C19H16F2N2O5/c1-3-27-18(26)19(2)17(25)23-14-7-5-11(9-15(14)28-19)22-16(24)12-8-10(20)4-6-13(12)21/h4-9H,3H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | HMWZBMPSBVUEPI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|