About (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate
(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate (PubChem CID 139201239) has the molecular formula C10H11ClN2O2
and a molecular weight of 226.66 g/mol. Its IUPAC name is (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate.
Molecular Properties
| Compound Name | (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate |
| PubChem CID | 139201239 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate |
| SMILES | O.O/N=C/c1cc[nH+]c2ccccc12.[Cl-] |
| InChI | InChI=1S/C10H8N2O.ClH.H2O/c13-12-7-8-5-6-11-10-4-2-1-3-9(8)10;;/h1-7,13H;1H;1H2/b12-7+;; |
| InChIKey | UBDHYQBTQOKFPX-CURPJKDSSA-N |
| XLogP | -2.36 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate?
The IUPAC name of (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate (CID 139201239) is (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate.
What is the SMILES notation for (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate?
The canonical SMILES for (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate is O.O/N=C/c1cc[nH+]c2ccccc12.[Cl-].
What is the InChIKey of (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate?
The InChIKey is UBDHYQBTQOKFPX-CURPJKDSSA-N. The full InChI is InChI=1S/C10H8N2O.ClH.H2O/c13-12-7-8-5-6-11-10-4-2-1-3-9(8)10;;/h1-7,13H;1H;1H2/b12-7+;;.
What are the key properties of (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate?
(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate has a molecular weight of 226.66 g/mol, XLogP of -2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine;chloride;hydrate is sourced from PubChem (CID 139201239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).