About 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine
2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine (PubChem CID 139202987) has the molecular formula C24H18N4O9
and a molecular weight of 506.43 g/mol. Its IUPAC name is 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine.
Molecular Properties
| Compound Name | 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine |
| PubChem CID | 139202987 |
| Molecular Formula | C24H18N4O9 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine |
| SMILES | O/N=C/c1cc[nH+]c2ccccc12.O=C(O)c1ccccc1[N+](=O)[O-].O=C([O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N2O.2C7H5NO4/c13-12-7-8-5-6-11-10-4-2-1-3-9(8)10;2*9-7(10)5-3-1-2-4-6(5)8(11)12/h1-7,13H;2*1-4H,(H,9,10)/b12-7+;; |
| InChIKey | BRDJRPFGFOUZSV-CURPJKDSSA-N |
| XLogP | 2.71 |
| TPSA | 210.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine?
The IUPAC name of 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine (CID 139202987) is 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine.
What is the SMILES notation for 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine?
The canonical SMILES for 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine is O/N=C/c1cc[nH+]c2ccccc12.O=C(O)c1ccccc1[N+](=O)[O-].O=C([O-])c1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine?
The InChIKey is BRDJRPFGFOUZSV-CURPJKDSSA-N. The full InChI is InChI=1S/C10H8N2O.2C7H5NO4/c13-12-7-8-5-6-11-10-4-2-1-3-9(8)10;2*9-7(10)5-3-1-2-4-6(5)8(11)12/h1-7,13H;2*1-4H,(H,9,10)/b12-7+;;.
What are the key properties of 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine?
2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine has a molecular weight of 506.43 g/mol, XLogP of 2.71, 5 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobenzoate;2-nitrobenzoic acid;(NE)-N-(quinolin-1-ium-4-ylmethylidene)hydroxylamine is sourced from PubChem (CID 139202987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).