C9H18N5O+ — CID 139201804
(3aS,6aS)-1,3,4,6-tetramethyl-2-(methylamino)-3a,6a-dihydroimidazo[4,5-d]imidazol-3-ium-5-one (PubChem CID 139201804) has the molecular formula C9H18N5O+ and a molecular weight of 212.28 g/mol. Its IUPAC name is (3aS,6aS)-1,3,4,6-tetramethyl-2-(methylamino)-3a,6a-dihydroimidazo[4,5-d]imidazol-3-ium-5-one.
| Compound Name | (3aS,6aS)-1,3,4,6-tetramethyl-2-(methylamino)-3a,6a-dihydroimidazo[4,5-d]imidazol-3-ium-5-one |
|---|---|
| PubChem CID | 139201804 |
| Molecular Formula | C9H18N5O+ |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (3aS,6aS)-1,3,4,6-tetramethyl-2-(methylamino)-3a,6a-dihydroimidazo[4,5-d]imidazol-3-ium-5-one |
| SMILES | CNC1=[N+](C)[C@H]2[C@H](N(C)C(=O)N2C)N1C |
| InChI | InChI=1S/C9H17N5O/c1-10-8-11(2)6-7(12(8)3)14(5)9(15)13(6)4/h6-7H,1-5H3/p+1/t6-,7+ |
| InChIKey | UPSDMPVVVAFZTE-KNVOCYPGSA-O |
| XLogP | -1.20 |
| TPSA | 41.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|