C8H13N4OSe — CID 175679335
4-methyl-1-propyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one (PubChem CID 175679335) has the molecular formula C8H13N4OSe and a molecular weight of 260.18 g/mol.
| Compound Name | 4-methyl-1-propyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one |
|---|---|
| PubChem CID | 175679335 |
| Molecular Formula | C8H13N4OSe |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | — |
| SMILES | CCCN1C(=O)NC2C1N=C([Se])N2C |
| InChI | InChI=1S/C8H13N4OSe/c1-3-4-12-6-5(9-7(12)13)11(2)8(14)10-6/h5-6H,3-4H2,1-2H3,(H,9,13) |
| InChIKey | QNJXTAJOXFBLJR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|