C19H22N4O5 — CID 139203756
heptanedioic acid;N-[(E)-pyridin-3-ylmethylideneamino]pyridine-2-carboxamide (PubChem CID 139203756) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is heptanedioic acid;N-[(E)-pyridin-3-ylmethylideneamino]pyridine-2-carboxamide.
| Compound Name | heptanedioic acid;N-[(E)-pyridin-3-ylmethylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139203756 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | heptanedioic acid;N-[(E)-pyridin-3-ylmethylideneamino]pyridine-2-carboxamide |
| SMILES | O=C(N/N=C/c1cccnc1)c1ccccn1.O=C(O)CCCCCC(=O)O |
| InChI | InChI=1S/C12H10N4O.C7H12O4/c17-12(11-5-1-2-7-14-11)16-15-9-10-4-3-6-13-8-10;8-6(9)4-2-1-3-5-7(10)11/h1-9H,(H,16,17);1-5H2,(H,8,9)(H,10,11)/b15-9+; |
| InChIKey | LXWKWGRRSYNQIK-NSPIFIKESA-N |
| XLogP | 2.35 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|