C21H26N4O5 — CID 139203759
nonanedioic acid;N-[(E)-pyridin-3-ylmethylideneamino]pyridine-2-carboxamide (PubChem CID 139203759) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is nonanedioic acid;N-[(E)-pyridin-3-ylmethylideneamino]pyridine-2-carboxamide.
| Compound Name | nonanedioic acid;N-[(E)-pyridin-3-ylmethylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139203759 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | nonanedioic acid;N-[(E)-pyridin-3-ylmethylideneamino]pyridine-2-carboxamide |
| SMILES | O=C(N/N=C/c1cccnc1)c1ccccn1.O=C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C12H10N4O.C9H16O4/c17-12(11-5-1-2-7-14-11)16-15-9-10-4-3-6-13-8-10;10-8(11)6-4-2-1-3-5-7-9(12)13/h1-9H,(H,16,17);1-7H2,(H,10,11)(H,12,13)/b15-9+; |
| InChIKey | DRWFNGMBQFHCFH-NSPIFIKESA-N |
| XLogP | 3.13 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|