C24H20N4O8 — CID 139204052
3-methyl-1-[(1S)-3-oxo-1H-2-benzofuran-1-yl]imidazolidine-2,4-dione (PubChem CID 139204052) has the molecular formula C24H20N4O8 and a molecular weight of 492.44 g/mol. Its IUPAC name is 3-methyl-1-[(1S)-3-oxo-1H-2-benzofuran-1-yl]imidazolidine-2,4-dione.
| Compound Name | 3-methyl-1-[(1S)-3-oxo-1H-2-benzofuran-1-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139204052 |
| Molecular Formula | C24H20N4O8 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 3-methyl-1-[(1S)-3-oxo-1H-2-benzofuran-1-yl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN([C@H]2OC(=O)c3ccccc32)C1=O.CN1C(=O)CN([C@H]2OC(=O)c3ccccc32)C1=O |
| InChI | InChI=1S/2C12H10N2O4/c2*1-13-9(15)6-14(12(13)17)10-7-4-2-3-5-8(7)11(16)18-10/h2*2-5,10H,6H2,1H3/t2*10-/m00/s1 |
| InChIKey | VLFRAIAYFFSDJZ-LARVRRBISA-N |
| XLogP | 1.50 |
| TPSA | 133.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|