C10H4INOS4 — CID 139205484
6-(2-iodophenyl)-5-sulfanylidene-[1,3]dithiolo[4,5-d][1,3]thiazol-2-one (PubChem CID 139205484) has the molecular formula C10H4INOS4 and a molecular weight of 409.32 g/mol. Its IUPAC name is 6-(2-iodophenyl)-5-sulfanylidene-[1,3]dithiolo[4,5-d][1,3]thiazol-2-one.
| Compound Name | 6-(2-iodophenyl)-5-sulfanylidene-[1,3]dithiolo[4,5-d][1,3]thiazol-2-one |
|---|---|
| PubChem CID | 139205484 |
| Molecular Formula | C10H4INOS4 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.82 |
| IUPAC Name | 6-(2-iodophenyl)-5-sulfanylidene-[1,3]dithiolo[4,5-d][1,3]thiazol-2-one |
| SMILES | O=c1sc2sc(=S)n(-c3ccccc3I)c2s1 |
| InChI | InChI=1S/C10H4INOS4/c11-5-3-1-2-4-6(5)12-7-8(16-9(12)14)17-10(13)15-7/h1-4H |
| InChIKey | SVPZSMXLJXBNTK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|