C9H7NS4 — CID 15807056
3-phenyl-4,5-bis(sulfanyl)-1,3-thiazole-2-thione (PubChem CID 15807056) has the molecular formula C9H7NS4 and a molecular weight of 257.43 g/mol. Its IUPAC name is 3-phenyl-4,5-bis(sulfanyl)-1,3-thiazole-2-thione.
| Compound Name | 3-phenyl-4,5-bis(sulfanyl)-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 15807056 |
| Molecular Formula | C9H7NS4 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | 3-phenyl-4,5-bis(sulfanyl)-1,3-thiazole-2-thione |
| SMILES | S=c1sc(S)c(S)n1-c1ccccc1 |
| InChI | InChI=1S/C9H7NS4/c11-7-8(12)14-9(13)10(7)6-4-2-1-3-5-6/h1-5,11-12H |
| InChIKey | PBHASPVYPXPZBZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 4.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|