C11H7NOS3 — CID 11043684
3-phenyl-2-sulfanylidenethieno[2,3-d][1,3]thiazol-6-one (PubChem CID 11043684) has the molecular formula C11H7NOS3 and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-phenyl-2-sulfanylidenethieno[2,3-d][1,3]thiazol-6-one.
| Compound Name | 3-phenyl-2-sulfanylidenethieno[2,3-d][1,3]thiazol-6-one |
|---|---|
| PubChem CID | 11043684 |
| Molecular Formula | C11H7NOS3 |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 3-phenyl-2-sulfanylidenethieno[2,3-d][1,3]thiazol-6-one |
| SMILES | O=C1CSc2c1sc(=S)n2-c1ccccc1 |
| InChI | InChI=1S/C11H7NOS3/c13-8-6-15-10-9(8)16-11(14)12(10)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | YCCLJFFXADPYKN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|