C22H22CuN2O2 — CID 139206803
copper (Z)-3-[2-[[(Z)-4-oxido-4-phenylbut-3-en-2-ylidene]amino]ethylimino]-1-phenylbut-1-en-1-olate (PubChem CID 139206803) has the molecular formula C22H22CuN2O2 and a molecular weight of 409.98 g/mol. Its IUPAC name is copper (Z)-3-[2-[[(Z)-4-oxido-4-phenylbut-3-en-2-ylidene]amino]ethylimino]-1-phenylbut-1-en-1-olate.
| Compound Name | copper (Z)-3-[2-[[(Z)-4-oxido-4-phenylbut-3-en-2-ylidene]amino]ethylimino]-1-phenylbut-1-en-1-olate |
|---|---|
| PubChem CID | 139206803 |
| Molecular Formula | C22H22CuN2O2 |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | copper (Z)-3-[2-[[(Z)-4-oxido-4-phenylbut-3-en-2-ylidene]amino]ethylimino]-1-phenylbut-1-en-1-olate |
| SMILES | CC(/C=C(\[O-])c1ccccc1)=N\CC/N=C(C)/C=C(\[O-])c1ccccc1.[Cu+2] |
| InChI | InChI=1S/C22H24N2O2.Cu/c1-17(15-21(25)19-9-5-3-6-10-19)23-13-14-24-18(2)16-22(26)20-11-7-4-8-12-20;/h3-12,15-16,25-26H,13-14H2,1-2H3;/q;+2/p-2/b21-15-,22-16-,23-17+,24-18+; |
| InChIKey | ZWSLBBIGEVDGKF-GNVHNOTCSA-L |
| XLogP | 2.71 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|