C10H18Cl2O2 — CID 139206925
(1S,2S,5R)-2-chloro-2-(chloromethyl)-5-(2-hydroxypropan-2-yl)cyclohexan-1-ol (PubChem CID 139206925) has the molecular formula C10H18Cl2O2 and a molecular weight of 241.16 g/mol. Its IUPAC name is (1S,2S,5R)-2-chloro-2-(chloromethyl)-5-(2-hydroxypropan-2-yl)cyclohexan-1-ol.
| Compound Name | (1S,2S,5R)-2-chloro-2-(chloromethyl)-5-(2-hydroxypropan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 139206925 |
| Molecular Formula | C10H18Cl2O2 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (1S,2S,5R)-2-chloro-2-(chloromethyl)-5-(2-hydroxypropan-2-yl)cyclohexan-1-ol |
| SMILES | CC(C)(O)[C@@H]1CC[C@@](Cl)(CCl)[C@@H](O)C1 |
| InChI | InChI=1S/C10H18Cl2O2/c1-9(2,14)7-3-4-10(12,6-11)8(13)5-7/h7-8,13-14H,3-6H2,1-2H3/t7-,8+,10-/m1/s1 |
| InChIKey | VMSCHAXBCZSLKU-KHQFGBGNSA-N |
| XLogP | 2.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|