C13H23NO2 — CID 139207259
(2S,3S)-3-(1-adamantyl)-3-aminopropane-1,2-diol (PubChem CID 139207259) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (2S,3S)-3-(1-adamantyl)-3-aminopropane-1,2-diol.
| Compound Name | (2S,3S)-3-(1-adamantyl)-3-aminopropane-1,2-diol |
|---|---|
| PubChem CID | 139207259 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (2S,3S)-3-(1-adamantyl)-3-aminopropane-1,2-diol |
| SMILES | N[C@H]([C@H](O)CO)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H23NO2/c14-12(11(16)7-15)13-4-8-1-9(5-13)3-10(2-8)6-13/h8-12,15-16H,1-7,14H2/t8?,9?,10?,11-,12-,13?/m1/s1 |
| InChIKey | GUOCDWNOYRJXAJ-WRONPYNSSA-N |
| XLogP | 0.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |