C15H27NO4 — CID 134815023
(2R,3S,4R)-5-(1-adamantylamino)pentane-1,2,3,4-tetrol (PubChem CID 134815023) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is (2R,3S,4R)-5-(1-adamantylamino)pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4R)-5-(1-adamantylamino)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 134815023 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (2R,3S,4R)-5-(1-adamantylamino)pentane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)CNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H27NO4/c17-8-13(19)14(20)12(18)7-16-15-4-9-1-10(5-15)3-11(2-9)6-15/h9-14,16-20H,1-8H2/t9?,10?,11?,12-,13-,14+,15?/m1/s1 |
| InChIKey | WLRSGPYHQFWNQF-UWIVAKSDSA-N |
| XLogP | -0.38 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |