C13H22FNO3S — CID 58691917
(2S)-3-(1-adamantylamino)-2-fluoropropane-1-sulfonic acid (PubChem CID 58691917) has the molecular formula C13H22FNO3S and a molecular weight of 291.39 g/mol. Its IUPAC name is (2S)-3-(1-adamantylamino)-2-fluoropropane-1-sulfonic acid.
| Compound Name | (2S)-3-(1-adamantylamino)-2-fluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58691917 |
| Molecular Formula | C13H22FNO3S |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (2S)-3-(1-adamantylamino)-2-fluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C[C@@H](F)CNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H22FNO3S/c14-12(8-19(16,17)18)7-15-13-4-9-1-10(5-13)3-11(2-9)6-13/h9-12,15H,1-8H2,(H,16,17,18)/t9?,10?,11?,12-,13?/m0/s1 |
| InChIKey | KQXJNFDEMRICSH-RFMXUXEOSA-N |
| XLogP | 1.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|