C52H49N5O2 — CID 139207979
2-[4,6-bis[(E)-2-(9-hexylcarbazol-3-yl)ethenyl]pyrimidin-2-yl]isoindole-1,3-dione (PubChem CID 139207979) has the molecular formula C52H49N5O2 and a molecular weight of 776.00 g/mol. Its IUPAC name is 2-[4,6-bis[(E)-2-(9-hexylcarbazol-3-yl)ethenyl]pyrimidin-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[4,6-bis[(E)-2-(9-hexylcarbazol-3-yl)ethenyl]pyrimidin-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139207979 |
| Molecular Formula | C52H49N5O2 |
| Molecular Weight | 776.00 g/mol |
| Exact Mass | 775.39 |
| IUPAC Name | 2-[4,6-bis[(E)-2-(9-hexylcarbazol-3-yl)ethenyl]pyrimidin-2-yl]isoindole-1,3-dione |
| SMILES | CCCCCCn1c2ccccc2c2cc(/C=C/c3cc(/C=C/c4ccc5c(c4)c4ccccc4n5CCCCCC)nc(N4C(=O)c5ccccc5C4=O)n3)ccc21 |
| InChI | InChI=1S/C52H49N5O2/c1-3-5-7-15-31-55-46-21-13-11-17-40(46)44-33-36(25-29-48(44)55)23-27-38-35-39(54-52(53-38)57-50(58)42-19-9-10-20-43(42)51(57)59)28-24-37-26-30-49-45(34-37)41-18-12-14-22-47(41)56(49)32-16-8-6-4-2/h9-14,17-30,33-35H,3-8,15-16,31-32H2,1-2H3/b27-23+,28-24+ |
| InChIKey | QTQAYWVMHMLQPV-LMCGJEQXSA-N |
| XLogP | 12.99 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.00 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|