C53H26F12N4O2 — CID 163732176
2-[2,5-bis[3-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-pyridinyl]isoindole-1,3-dione (PubChem CID 163732176) has the molecular formula C53H26F12N4O2 and a molecular weight of 978.79 g/mol. Its IUPAC name is 2-[2,5-bis[3-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-pyridinyl]isoindole-1,3-dione.
| Compound Name | 2-[2,5-bis[3-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-pyridinyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163732176 |
| Molecular Formula | C53H26F12N4O2 |
| Molecular Weight | 978.79 g/mol |
| Exact Mass | 978.19 |
| IUPAC Name | 2-[2,5-bis[3-[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-4-pyridinyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(-n2c3ccccc3c3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)ccc32)ncc1-n1c2ccccc2c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C53H26F12N4O2/c54-50(55,56)31-17-29(18-32(23-31)51(57,58)59)27-13-15-43-39(21-27)35-7-3-5-11-41(35)67(43)46-26-66-47(25-45(46)69-48(70)37-9-1-2-10-38(37)49(69)71)68-42-12-6-4-8-36(42)40-22-28(14-16-44(40)68)30-19-33(52(60,61)62)24-34(20-30)53(63,64)65/h1-26H |
| InChIKey | LANGIXTXIWCVPS-UHFFFAOYSA-N |
| XLogP | 15.49 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.79 |
| LogP ≤ 5 | 15.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|