C19H22N6O3 — CID 139208718
5-[8-methoxy-1-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one (PubChem CID 139208718) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-[8-methoxy-1-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one.
| Compound Name | 5-[8-methoxy-1-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 139208718 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-[8-methoxy-1-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one |
| SMILES | C=CC(=O)N1CC[C@H](Nc2nc(C3NNC(=O)N3)cc3cccc(OC)c23)C1 |
| InChI | InChI=1S/C19H22N6O3/c1-3-15(26)25-8-7-12(10-25)20-18-16-11(5-4-6-14(16)28-2)9-13(21-18)17-22-19(27)24-23-17/h3-6,9,12,17,23H,1,7-8,10H2,2H3,(H,20,21)(H2,22,24,27)/t12-,17?/m0/s1 |
| InChIKey | JSJOFLTUOMRASQ-WHUIICBVSA-N |
| XLogP | 1.26 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|