C26H28N4O3 — CID 167131582
1-[3-[[3-[4-(3-ethoxyphenoxy)anilino]-4-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 167131582) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-[3-[[3-[4-(3-ethoxyphenoxy)anilino]-4-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[3-[4-(3-ethoxyphenoxy)anilino]-4-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167131582 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 1-[3-[[3-[4-(3-ethoxyphenoxy)anilino]-4-pyridinyl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2ccncc2Nc2ccc(Oc3cccc(OCC)c3)cc2)C1 |
| InChI | InChI=1S/C26H28N4O3/c1-3-26(31)30-15-13-20(18-30)29-24-12-14-27-17-25(24)28-19-8-10-21(11-9-19)33-23-7-5-6-22(16-23)32-4-2/h3,5-12,14,16-17,20,28H,1,4,13,15,18H2,2H3,(H,27,29) |
| InChIKey | BKUGAKOVHJAJRS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|