C24H28N2O2 — CID 139212229
N-butyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-9H-fluorene-9-carboxamide (PubChem CID 139212229) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-butyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-9H-fluorene-9-carboxamide.
| Compound Name | N-butyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-9H-fluorene-9-carboxamide |
|---|---|
| PubChem CID | 139212229 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | N-butyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-9H-fluorene-9-carboxamide |
| SMILES | CCCCNC(=O)C1c2ccccc2-c2ccc(C3=N[C@@H](C(C)C)CO3)cc21 |
| InChI | InChI=1S/C24H28N2O2/c1-4-5-12-25-23(27)22-19-9-7-6-8-17(19)18-11-10-16(13-20(18)22)24-26-21(14-28-24)15(2)3/h6-11,13,15,21-22H,4-5,12,14H2,1-3H3,(H,25,27)/t21-,22?/m1/s1 |
| InChIKey | AGHTYOASGURMBN-ZMFCMNQTSA-N |
| XLogP | 4.52 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|