C56H40CoN8O2+2 — CID 139212396
cobalt(2+);bis(N-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]formamide) (PubChem CID 139212396) has the molecular formula C56H40CoN8O2+2 and a molecular weight of 915.92 g/mol. Its IUPAC name is cobalt(2+);bis(N-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]formamide).
| Compound Name | cobalt(2+);bis(N-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]formamide) |
|---|---|
| PubChem CID | 139212396 |
| Molecular Formula | C56H40CoN8O2+2 |
| Molecular Weight | 915.92 g/mol |
| Exact Mass | 915.26 |
| IUPAC Name | cobalt(2+);bis(N-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]formamide) |
| SMILES | O=CNc1ccc(-c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)cc1.O=CNc1ccc(-c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)cc1.[Co+2] |
| InChI | InChI=1S/2C28H20N4O.Co/c2*33-19-31-24-13-11-21(12-14-24)20-7-9-22(10-8-20)23-17-27(25-5-1-3-15-29-25)32-28(18-23)26-6-2-4-16-30-26;/h2*1-19H,(H,31,33);/q;;+2 |
| InChIKey | JOHMGDXFEAACSN-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.92 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|