C17H16F6N2 — CID 139212404
3-[2-(1,2-dimethylpyrrol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1,2-dimethylpyrrole (PubChem CID 139212404) has the molecular formula C17H16F6N2 and a molecular weight of 362.32 g/mol. Its IUPAC name is 3-[2-(1,2-dimethylpyrrol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1,2-dimethylpyrrole.
| Compound Name | 3-[2-(1,2-dimethylpyrrol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1,2-dimethylpyrrole |
|---|---|
| PubChem CID | 139212404 |
| Molecular Formula | C17H16F6N2 |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-[2-(1,2-dimethylpyrrol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-1,2-dimethylpyrrole |
| SMILES | Cc1c(C2=C(c3ccn(C)c3C)C(F)(F)C(F)(F)C2(F)F)ccn1C |
| InChI | InChI=1S/C17H16F6N2/c1-9-11(5-7-24(9)3)13-14(12-6-8-25(4)10(12)2)16(20,21)17(22,23)15(13,18)19/h5-8H,1-4H3 |
| InChIKey | HNKQAFSURRHXED-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|