C54H48N4O4S2Zn — CID 139213552
zinc 4-[10-(4-carboxyphenyl)-15,20-bis(5-hexylthiophen-2-yl)porphyrin-21,23-diid-5-yl]benzoic acid (PubChem CID 139213552) has the molecular formula C54H48N4O4S2Zn and a molecular weight of 946.53 g/mol. Its IUPAC name is zinc 4-[10-(4-carboxyphenyl)-15,20-bis(5-hexylthiophen-2-yl)porphyrin-21,23-diid-5-yl]benzoic acid.
| Compound Name | zinc 4-[10-(4-carboxyphenyl)-15,20-bis(5-hexylthiophen-2-yl)porphyrin-21,23-diid-5-yl]benzoic acid |
|---|---|
| PubChem CID | 139213552 |
| Molecular Formula | C54H48N4O4S2Zn |
| Molecular Weight | 946.53 g/mol |
| Exact Mass | 944.24 |
| IUPAC Name | zinc 4-[10-(4-carboxyphenyl)-15,20-bis(5-hexylthiophen-2-yl)porphyrin-21,23-diid-5-yl]benzoic acid |
| SMILES | CCCCCCc1ccc(-c2c3nc(c(-c4ccc(CCCCCC)s4)c4ccc([n-]4)c(-c4ccc(C(=O)O)cc4)c4nc(c(-c5ccc(C(=O)O)cc5)c5ccc2[n-]5)C=C4)C=C3)s1.[Zn+2] |
| InChI | InChI=1S/C54H50N4O4S2.Zn/c1-3-5-7-9-11-37-21-31-47(63-37)51-43-27-25-41(56-43)49(33-13-17-35(18-14-33)53(59)60)39-23-24-40(55-39)50(34-15-19-36(20-16-34)54(61)62)42-26-28-44(57-42)52(46-30-29-45(51)58-46)48-32-22-38(64-48)12-10-8-6-4-2;/h13-32H,3-12H2,1-2H3,(H4,55,56,57,58,59,60,61,62);/q;+2/p-2/b49-39-,49-41-,50-40-,50-42-,51-43+,51-45+,52-44+,52-46+; |
| InChIKey | GDQRZILTSHGBFE-XJAJYACQSA-L |
| XLogP | 14.34 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.53 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|