C13H14N6O — CID 139214064
(3Z)-1-[(dimethylamino)methyl]-3-(1,2,4-triazol-4-ylimino)indol-2-one (PubChem CID 139214064) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is (3Z)-1-[(dimethylamino)methyl]-3-(1,2,4-triazol-4-ylimino)indol-2-one.
| Compound Name | (3Z)-1-[(dimethylamino)methyl]-3-(1,2,4-triazol-4-ylimino)indol-2-one |
|---|---|
| PubChem CID | 139214064 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (3Z)-1-[(dimethylamino)methyl]-3-(1,2,4-triazol-4-ylimino)indol-2-one |
| SMILES | CN(C)CN1C(=O)/C(=N\n2cnnc2)c2ccccc21 |
| InChI | InChI=1S/C13H14N6O/c1-17(2)9-19-11-6-4-3-5-10(11)12(13(19)20)16-18-7-14-15-8-18/h3-8H,9H2,1-2H3/b16-12- |
| InChIKey | WFMDAEAISIYDNE-VBKFSLOCSA-N |
| XLogP | 0.40 |
| TPSA | 66.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|