C30H34BrN5O2 — CID 25033923
6-bromo-3-[(E)-[1-[(dicyclohexylamino)methyl]-2-oxoindol-3-ylidene]amino]-2-methylquinazolin-4-one (PubChem CID 25033923) has the molecular formula C30H34BrN5O2 and a molecular weight of 576.54 g/mol. Its IUPAC name is 6-bromo-3-[(E)-[1-[(dicyclohexylamino)methyl]-2-oxoindol-3-ylidene]amino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(E)-[1-[(dicyclohexylamino)methyl]-2-oxoindol-3-ylidene]amino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 25033923 |
| Molecular Formula | C30H34BrN5O2 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 6-bromo-3-[(E)-[1-[(dicyclohexylamino)methyl]-2-oxoindol-3-ylidene]amino]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1/N=C1/C(=O)N(CN(C2CCCCC2)C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C30H34BrN5O2/c1-20-32-26-17-16-21(31)18-25(26)29(37)36(20)33-28-24-14-8-9-15-27(24)35(30(28)38)19-34(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h8-9,14-18,22-23H,2-7,10-13,19H2,1H3/b33-28+ |
| InChIKey | BPZAGOSYHXNGNX-PJJLUWSFSA-N |
| XLogP | 5.99 |
| TPSA | 70.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|