C19H17BrN4O3 — CID 135501698
6-bromo-3-[(Z)-[5-(4-methoxyphenyl)-1,2-oxazolidin-3-ylidene]amino]-2-methylquinazolin-4-one (PubChem CID 135501698) has the molecular formula C19H17BrN4O3 and a molecular weight of 429.27 g/mol. Its IUPAC name is 6-bromo-3-[(Z)-[5-(4-methoxyphenyl)-1,2-oxazolidin-3-ylidene]amino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(Z)-[5-(4-methoxyphenyl)-1,2-oxazolidin-3-ylidene]amino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 135501698 |
| Molecular Formula | C19H17BrN4O3 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 6-bromo-3-[(Z)-[5-(4-methoxyphenyl)-1,2-oxazolidin-3-ylidene]amino]-2-methylquinazolin-4-one |
| SMILES | COc1ccc(C2C/C(=N/n3c(C)nc4ccc(Br)cc4c3=O)NO2)cc1 |
| InChI | InChI=1S/C19H17BrN4O3/c1-11-21-16-8-5-13(20)9-15(16)19(25)24(11)22-18-10-17(27-23-18)12-3-6-14(26-2)7-4-12/h3-9,17H,10H2,1-2H3,(H,22,23) |
| InChIKey | OPDHGQRSXABCMM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|