C24H19N3O4 — CID 139215579
ethyl 6-[2-(4-hydroxyphenyl)pyrimidin-4-yl]-4-oxo-2-phenyl-1H-pyridine-3-carboxylate (PubChem CID 139215579) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is ethyl 6-[2-(4-hydroxyphenyl)pyrimidin-4-yl]-4-oxo-2-phenyl-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-[2-(4-hydroxyphenyl)pyrimidin-4-yl]-4-oxo-2-phenyl-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139215579 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | ethyl 6-[2-(4-hydroxyphenyl)pyrimidin-4-yl]-4-oxo-2-phenyl-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)[nH]c(-c2ccnc(-c3ccc(O)cc3)n2)cc1=O |
| InChI | InChI=1S/C24H19N3O4/c1-2-31-24(30)21-20(29)14-19(26-22(21)15-6-4-3-5-7-15)18-12-13-25-23(27-18)16-8-10-17(28)11-9-16/h3-14,28H,2H2,1H3,(H,26,29) |
| InChIKey | GHFVZGKULKQLSH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |