C18H18N4O2 — CID 68947362
ethyl 5-(2-aminopyrimidin-4-yl)-2-(2-methylphenyl)-1H-pyrrole-3-carboxylate (PubChem CID 68947362) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is ethyl 5-(2-aminopyrimidin-4-yl)-2-(2-methylphenyl)-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-(2-aminopyrimidin-4-yl)-2-(2-methylphenyl)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 68947362 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | ethyl 5-(2-aminopyrimidin-4-yl)-2-(2-methylphenyl)-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccnc(N)n2)[nH]c1-c1ccccc1C |
| InChI | InChI=1S/C18H18N4O2/c1-3-24-17(23)13-10-15(14-8-9-20-18(19)22-14)21-16(13)12-7-5-4-6-11(12)2/h4-10,21H,3H2,1-2H3,(H2,19,20,22) |
| InChIKey | NYTBXDMXEGZUIR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |