C15H13Cl2N5O5S — CID 52939598
5-(2-aminopyrimidin-4-yl)-2-(2,4-dichlorophenyl)-1H-pyrrole-3-carboxamide;sulfuric acid (PubChem CID 52939598) has the molecular formula C15H13Cl2N5O5S and a molecular weight of 446.27 g/mol. Its IUPAC name is 5-(2-aminopyrimidin-4-yl)-2-(2,4-dichlorophenyl)-1H-pyrrole-3-carboxamide;sulfuric acid.
| Compound Name | 5-(2-aminopyrimidin-4-yl)-2-(2,4-dichlorophenyl)-1H-pyrrole-3-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 52939598 |
| Molecular Formula | C15H13Cl2N5O5S |
| Molecular Weight | 446.27 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | 5-(2-aminopyrimidin-4-yl)-2-(2,4-dichlorophenyl)-1H-pyrrole-3-carboxamide;sulfuric acid |
| SMILES | NC(=O)c1cc(-c2ccnc(N)n2)[nH]c1-c1ccc(Cl)cc1Cl.O=S(=O)(O)O |
| InChI | InChI=1S/C15H11Cl2N5O.H2O4S/c16-7-1-2-8(10(17)5-7)13-9(14(18)23)6-12(21-13)11-3-4-20-15(19)22-11;1-5(2,3)4/h1-6,21H,(H2,18,23)(H2,19,20,22);(H2,1,2,3,4) |
| InChIKey | CPUCDYIQPUYHBE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 185.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|